(2,3-Dimethoxyphenyl)(4-(6-methoxypyridazin-3-yl)piperazin-1-yl)methanone hydrochloride
Modify Date: 2025-08-29 09:56:12
(2,3-Dimethoxyphenyl)(4-(6-methoxypyridazin-3-yl)piperazin-1-yl)methanone hydrochloride structure
|
Common Name | (2,3-Dimethoxyphenyl)(4-(6-methoxypyridazin-3-yl)piperazin-1-yl)methanone hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1189655-27-3 | Molecular Weight | 394.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H23ClN4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (2,3-Dimethoxyphenyl)(4-(6-methoxypyridazin-3-yl)piperazin-1-yl)methanone hydrochloride |
|---|
| Molecular Formula | C18H23ClN4O4 |
|---|---|
| Molecular Weight | 394.9 |
| InChIKey | ZKWPUWGIGBEUPX-UHFFFAOYSA-N |
| SMILES | COc1ccc(N2CCN(C(=O)c3cccc(OC)c3OC)CC2)nn1.Cl |
|
Name: Modulation of AMPAR-stargazin complexes
Source: Vanderbilt Screening Center for GPCRs, Ion Channels and Transporters
Target: Stargazin (mouse)
External Id: WaveGuideAssay:441
|
Total 1, Current Page 1 of 1
1