Molindone-d8 structure
|
Common Name | Molindone-d8 | ||
|---|---|---|---|---|
| CAS Number | 1189805-13-7 | Molecular Weight | 284.42300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H16D8N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Molindone-d8Molindone-d8 is the deuterium labeled Molindone. Molindone hydrochloride (EN-1733A) is a therapeutic antipsychotic, used in the treatment of schizophrenia, works by blocking the effects of dopamine in the brain, leading to diminished psychoses[1][2]. |
| Name | Molindone-d8 |
|---|---|
| Synonym | More Synonyms |
| Description | Molindone-d8 is the deuterium labeled Molindone. Molindone hydrochloride (EN-1733A) is a therapeutic antipsychotic, used in the treatment of schizophrenia, works by blocking the effects of dopamine in the brain, leading to diminished psychoses[1][2]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C16H16D8N2O2 |
|---|---|
| Molecular Weight | 284.42300 |
| Exact Mass | 284.23400 |
| PSA | 45.33000 |
| LogP | 1.90070 |
| InChIKey | KLPWJLBORRMFGK-COMRDEPKSA-N |
| SMILES | CCc1c(C)[nH]c2c1C(=O)C(CN1CCOCC1)CC2 |
| 3-ethyl-2-methyl-5-[(2,2,3,3,5,5,6,6-octadeuteriomorpholin-4-yl)methyl]-1,5,6,7-tetrahydroindol-4-one |