(±)-Methotrimeprazine (D6) structure
|
Common Name | (±)-Methotrimeprazine (D6) | ||
|---|---|---|---|---|
| CAS Number | 1189805-51-3 | Molecular Weight | 334.51 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | N/A | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of (±)-Methotrimeprazine (D6)(±)-Methotrimeprazine (D6) is the deuterium labeled Methotrimeprazine, which is a D3 dopamine and Histamine H1 receptor antagonist. |
| Name | (±)-Methotrimeprazine (D6) |
|---|
| Description | (±)-Methotrimeprazine (D6) is the deuterium labeled Methotrimeprazine, which is a D3 dopamine and Histamine H1 receptor antagonist. |
|---|---|
| Related Catalog |
| Molecular Weight | 334.51 |
|---|---|
| InChIKey | VRQVVMDWGGWHTJ-XERRXZQWSA-N |
| SMILES | COc1ccc2c(c1)N(CC(C)CN(C)C)c1ccccc1S2 |