4,4',4''-Nitrilotribenzoic acid structure
|
Common Name | 4,4',4''-Nitrilotribenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 118996-38-6 | Molecular Weight | 377.347 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 690.0±50.0 °C at 760 mmHg | |
| Molecular Formula | C21H15NO6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 371.1±30.1 °C | |
| Name | 4,4',4''-Nitrilotribenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 690.0±50.0 °C at 760 mmHg |
| Molecular Formula | C21H15NO6 |
| Molecular Weight | 377.347 |
| Flash Point | 371.1±30.1 °C |
| Exact Mass | 377.089935 |
| PSA | 115.14000 |
| LogP | 5.69 |
| Vapour Pressure | 0.0±2.3 mmHg at 25°C |
| Index of Refraction | 1.710 |
| InChIKey | VEBUOOBGPZWCFE-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccc(N(c2ccc(C(=O)O)cc2)c2ccc(C(=O)O)cc2)cc1 |
|
~88%
4,4',4''-Nitril... CAS#:118996-38-6 |
| Literature: Wang, Jian; He, Cheng; Wu, Pengyan; Wang, Jing; Duan, Chunying Journal of the American Chemical Society, 2011 , vol. 133, # 32 p. 12402 - 12405 |
|
~%
4,4',4''-Nitril... CAS#:118996-38-6 |
| Literature: Wang, Jian; He, Cheng; Wu, Pengyan; Wang, Jing; Duan, Chunying Journal of the American Chemical Society, 2011 , vol. 133, # 32 p. 12402 - 12405 |
|
~28%
4,4',4''-Nitril... CAS#:118996-38-6 |
| Literature: Dapperheld, Steffen; Steckhan, Eberhard; Grosse Brinkhaus, Karl-Heinz; Esch, Thomas Chemische Berichte, 1991 , vol. 124, # 11 p. 2557 - 2568 |
| [2,2':6',2''-Terpyridine]-4,4',4''-tricarboxylic acid |
| 4,4',4''-tricarboxyltriphenylamine |
| 4,4',4''-Nitrilotribenzoic acid |
| 2,2':6',2''-pyridine-4,4',4''-tricarboxylic acid |
| 4,4',4"-tricarboxy-2,2':6',2"-terpyridine |
| 4,4',4''-tricarboxylic-2,2':6',2''-terpyridyl |
| Benzoic acid, 4,4',4''-nitrilotris- |
| 4,4',4''-nitrilotrisbenzoic acid |
| 4,4',4''-tricarboxytriphenylamine |