rac-Tocol structure
|
Common Name | rac-Tocol | ||
|---|---|---|---|---|
| CAS Number | 119-98-2 | Molecular Weight | 388.62600 | |
| Density | 0.938g/cm3 | Boiling Point | 494ºC at 760mmHg | |
| Molecular Formula | C26H44O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 196.7ºC | |
Use of rac-Tocol(±)-Tocol is a synthetic vitamin E derivative. Unlike (±)-α-tocopherol, (±)-tocol does not suppress retinol-induced erythrocyte hemolysis or increase microviscosity of rat liver phosphatidylcholine (PC) liposomes. |
| Name | 2-methyl-2-(4,8,12-trimethyltridecyl)-3,4-dihydrochromen-6-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 0.938g/cm3 |
|---|---|
| Boiling Point | 494ºC at 760mmHg |
| Molecular Formula | C26H44O2 |
| Molecular Weight | 388.62600 |
| Flash Point | 196.7ºC |
| Exact Mass | 388.33400 |
| PSA | 29.46000 |
| LogP | 7.91500 |
| Vapour Pressure | 0mmHg at 25°C |
| Index of Refraction | 1.494 |
| InChIKey | DFUSDJMZWQVQSF-UHFFFAOYSA-N |
| SMILES | CC(C)CCCC(C)CCCC(C)CCCC1(C)CCc2cc(O)ccc2O1 |
| HS Code | 2932999099 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 3 | |
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Desmethyltocopherol |
| Tocol |
| UNII-S2XEE7OB8X |
| 2-Methyl-2-phytyl-6-hydroxychroman |
| 6-Hydroxy-2-methyl-2-phytylchroman |
| 2-Methyl-2-phytyl-6-chromanol |