5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid
Modify Date: 2026-08-03 10:43:05
![5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid Structure](https://www.chemsrc.com/extcaspic/229/1190298-73-7.png)
5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid structure
|
Common Name | 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid | ||
|---|---|---|---|---|
| CAS Number | 1190298-73-7 | Molecular Weight | 358.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H14O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H14O8 |
|---|---|
| Molecular Weight | 358.3 |
| InChIKey | VGKXMWNZEVDSQM-UHFFFAOYSA-N |
| SMILES | Cc1c(CC(=O)O)c(=O)oc2cc(OCc3ccc(C(=O)O)o3)ccc12 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid? |
| A: Molecular formula of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid is C18H14O8. |
| Q: What is the molecular weight of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid? |
| A: Molecular weight of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid is 358.3. |
| Q: What is the English name of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid? |
| A: The English name of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid is 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid. |
| Q: What is the Chinese name of 1190298-73-7? |
| A: Chinese name of 1190298-73-7 is 1190298-73-7. |
| Q: What is the InChIKey of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid? |
| A: InChIKey of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid is VGKXMWNZEVDSQM-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid? |
| A: CAS number of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid is 1190298-73-7. |
| Q: What is the SMILES notation of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid? |
| A: SMILES notation of 5-({[3-(carboxymethyl)-4-methyl-2-oxo-2H-chromen-7-yl]oxy}methyl)-2-furoic acid is Cc1c(CC(=O)O)c(=O)oc2cc(OCc3ccc(C(=O)O)o3)ccc12. |