7-Benzyloxy-1,2-dihydro-3-naphthoic acid
Modify Date: 2026-08-03 18:37:09
7-Benzyloxy-1,2-dihydro-3-naphthoic acid structure
|
Common Name | 7-Benzyloxy-1,2-dihydro-3-naphthoic acid | ||
|---|---|---|---|---|
| CAS Number | 119034-96-7 | Molecular Weight | 280.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H16O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 7-Benzyloxy-1,2-dihydro-3-naphthoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C18H16O3 |
|---|---|
| Molecular Weight | 280.3 |
| InChIKey | INTCREPVOCRRKW-UHFFFAOYSA-N |
| SMILES | O=C(O)C1=Cc2ccc(OCc3ccccc3)cc2CC1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 119034-96-7? |
| A: Chinese name of 119034-96-7 is 119034-96-7. |
| Q: What is the CAS number of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid? |
| A: CAS number of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid is 119034-96-7. |
| Q: What is the InChIKey of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid? |
| A: InChIKey of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid is INTCREPVOCRRKW-UHFFFAOYSA-N. |
| Q: What is the molecular formula of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid? |
| A: Molecular formula of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid is C18H16O3. |
| Q: What is the molecular weight of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid? |
| A: Molecular weight of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid is 280.3. |
| Q: What is the English name of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid? |
| A: The English name of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid is 7-Benzyloxy-1,2-dihydro-3-naphthoic acid. |
| Q: What is the SMILES notation of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid? |
| A: SMILES notation of 7-Benzyloxy-1,2-dihydro-3-naphthoic acid is O=C(O)C1=Cc2ccc(OCc3ccccc3)cc2CC1. |