Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate
Modify Date: 2026-08-22 07:13:38
![Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate Structure](https://www.chemsrc.com/extcaspic/048/1191069-84-7.png)
Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate structure
|
Common Name | Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate | ||
|---|---|---|---|---|
| CAS Number | 1191069-84-7 | Molecular Weight | 464.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H19Cl2NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H19Cl2NO4S |
|---|---|
| Molecular Weight | 464.4 |
| InChIKey | UAGGFVXKADEIMR-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccc(CN(Cc2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate? |
| A: InChIKey of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate is UAGGFVXKADEIMR-UHFFFAOYSA-N. |
| Q: What is the molecular formula of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate? |
| A: Molecular formula of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate is C22H19Cl2NO4S. |
| Q: What is the English name of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate? |
| A: The English name of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate is Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate. |
| Q: What is the SMILES notation of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate? |
| A: SMILES notation of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate is COC(=O)c1ccc(CN(Cc2cccc(Cl)c2)S(=O)(=O)c2ccc(Cl)cc2)cc1. |
| Q: What is the CAS number of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate? |
| A: CAS number of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate is 1191069-84-7. |
| Q: What is the molecular weight of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate? |
| A: Molecular weight of Methyl 4-({(3-chlorobenzyl)[(4-chlorophenyl)sulfonyl]amino}methyl)benzoate is 464.4. |
| Q: What is the Chinese name of 1191069-84-7? |
| A: Chinese name of 1191069-84-7 is 1191069-84-7. |