ethyl 5-chloro-3-Methylbenzofuran-2-carboxylate
Modify Date: 2025-08-25 15:54:21
ethyl 5-chloro-3-Methylbenzofuran-2-carboxylate structure
|
Common Name | ethyl 5-chloro-3-Methylbenzofuran-2-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 119138-73-7 | Molecular Weight | 238.66700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H11ClO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 5-chloro-3-methylbenzo[b]furan-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H11ClO3 |
|---|---|
| Molecular Weight | 238.66700 |
| Exact Mass | 238.04000 |
| PSA | 39.44000 |
| LogP | 3.57130 |
| InChIKey | JFVQSPWXZJLDHT-UHFFFAOYSA-N |
| SMILES | CCOC(=O)c1oc2ccc(Cl)cc2c1C |
|
Name: Glutathione reactivity in methanol/PBS assessed as compound-adduct formation at 500 n...
Source: ChEMBL
Target: N/A
External Id: CHEMBL4313097
|
|
Name: Kinetic solubility of the compound in pH 7.4 PBS by nephelometric method
Source: ChEMBL
Target: N/A
External Id: CHEMBL4313095
|
Total 2, Current Page 1 of 1
1
| ethyl 5-chloro-3-methyl-1-benzofuran-2-carboxylate |
| ethyl 5-chloro-3-methyl 2-benzofurancarboxylate |
| ethyl 5-chloro-3-methyl-2-benzofurancarboxylate |