6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride
Modify Date: 2026-08-21 13:47:50
6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride structure
|
Common Name | 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1191908-73-2 | Molecular Weight | 251.71 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H11ClFNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H11ClFNO2S |
|---|---|
| Molecular Weight | 251.71 |
| InChIKey | HVJSNNFBPCOLLH-UHFFFAOYSA-N |
| SMILES | Cl.NC1CCS(=O)(=O)c2ccc(F)cc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride? |
| A: SMILES notation of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride is Cl.NC1CCS(=O)(=O)c2ccc(F)cc21. |
| Q: What is the English name of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride? |
| A: The English name of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride is 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride. |
| Q: What is the Chinese name of 1191908-73-2? |
| A: Chinese name of 1191908-73-2 is 1191908-73-2. |
| Q: What is the molecular weight of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride? |
| A: Molecular weight of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride is 251.71. |
| Q: What is the CAS number of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride? |
| A: CAS number of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride is 1191908-73-2. |
| Q: What is the molecular formula of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride? |
| A: Molecular formula of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride is C9H11ClFNO2S. |
| Q: What is the InChIKey of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride? |
| A: InChIKey of 6-fluoro-1,1-dioxo-3,4-dihydro-2H-thiochromen-4-amine;hydrochloride is HVJSNNFBPCOLLH-UHFFFAOYSA-N. |