Licoflavanone structure
|
Common Name | Licoflavanone | ||
|---|---|---|---|---|
| CAS Number | 119240-82-3 | Molecular Weight | 338.35400 | |
| Density | 1.351g/cm3 | Boiling Point | 579ºC at 760mmHg | |
| Molecular Formula | C20H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 210ºC | |
Use of LicoflavanoneLicoflavanone (compopund 2) is a flavanone. Licoflavanone can be isolated from the MeOH extract of Air-dried leaves of G. glabra var. typica. Licoflavanone has antibacterial activity[1]. |
| Name | 5,7-dihydroxy-2-[4-hydroxy-3-(3-methylbut-2-enyl)phenyl]chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Description | Licoflavanone (compopund 2) is a flavanone. Licoflavanone can be isolated from the MeOH extract of Air-dried leaves of G. glabra var. typica. Licoflavanone has antibacterial activity[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.351g/cm3 |
|---|---|
| Boiling Point | 579ºC at 760mmHg |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.35400 |
| Flash Point | 210ºC |
| Exact Mass | 338.11500 |
| PSA | 90.90000 |
| LogP | 4.08550 |
| Vapour Pressure | 5.27E-14mmHg at 25°C |
| Index of Refraction | 1.667 |
| InChIKey | CGKWSLSAYABZTL-UHFFFAOYSA-N |
| SMILES | CC(C)=CCc1cc(C2CC(=O)c3c(O)cc(O)cc3O2)ccc1O |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| licoflavone |
| 3'-Prenylnaringenin |
| (2S)-3'-(3,3-Dimethylallyl)-4',5,7-trihydroxyflavonone |
| licoflavanone |
| Yinyanghuo D |