cis-tert-butyl 3-aMinocyclobutanecarboxylate hydrochloride structure
|
Common Name | cis-tert-butyl 3-aMinocyclobutanecarboxylate hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1192549-09-9 | Molecular Weight | 207.69800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | tert-butyl 3-aminocyclobutane-1-carboxylate,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H18ClNO2 |
|---|---|
| Molecular Weight | 207.69800 |
| Exact Mass | 207.10300 |
| PSA | 52.32000 |
| LogP | 2.56770 |
| InChIKey | ZYVBBJZQKIWNNB-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1CC(N)C1.Cl |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| cis-tert-Butyl 3-aminocyclobutanecarboxylate hydrochloride |