Edivoxetine hydrochloride structure
|
Common Name | Edivoxetine hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1194374-05-4 | Molecular Weight | 375.86300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H27ClFNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Edivoxetine hydrochlorideEdivoxetine (hydrochloride) is a selective and potent norepinephrine reuptake inhibitor (NERI) being used in depressive disorder or attention-deficit/hyperactivity disorder. |
| Name | (1R)-2-(5-fluoro-2-methoxyphenyl)-1-[(2S)-morpholin-2-yl]-1-(oxan-4-yl)ethanol,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Description | Edivoxetine (hydrochloride) is a selective and potent norepinephrine reuptake inhibitor (NERI) being used in depressive disorder or attention-deficit/hyperactivity disorder. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C18H27ClFNO4 |
|---|---|
| Molecular Weight | 375.86300 |
| Exact Mass | 375.16100 |
| PSA | 59.95000 |
| LogP | 2.65370 |
| InChIKey | WJDKGRLMNSHPON-CJRXIRLBSA-N |
| SMILES | COc1ccc(F)cc1CC(O)(C1CCOCC1)C1CNCCO1.Cl |
|
~80%
Edivoxetine hyd... CAS#:1194374-05-4 |
| Literature: ELI LILLY AND COMPANY Patent: WO2005/47272 A1, 2005 ; Location in patent: Page/Page column 84-86 ; WO 2005/047272 A1 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| EDIVOXETINE HYDROCHLORIDE |
| Edivoxetine hydrochoride |
| Edivoxetine HCl |