1-(4,6-Dibromothieno[3,4-b]thiophen-2-yl)-2-ethylhexan-1-one structure
|
Common Name | 1-(4,6-Dibromothieno[3,4-b]thiophen-2-yl)-2-ethylhexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 1194605-76-9 | Molecular Weight | 424.21400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16Br2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(4,6-dibromothieno[2,3-c]thiophen-2-yl)-2-ethylhexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16Br2OS2 |
|---|---|
| Molecular Weight | 424.21400 |
| Exact Mass | 421.90100 |
| PSA | 73.55000 |
| LogP | 6.88690 |
| InChIKey | UHHOTOYDCIDUJQ-UHFFFAOYSA-N |
| SMILES | CCCCC(CC)C(=O)c1cc2c(Br)sc(Br)c2s1 |
| HS Code | 2934999090 |
|---|
|
~82%
1-(4,6-Dibromot... CAS#:1194605-76-9 |
| Literature: Journal of the American Chemical Society, , vol. 131, # 43 p. 15586 - 15587 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4,6-Dibromothieno[3,4-b]thiophen-2-yl)-2-ethylhexan-1-one |