4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl structure
|
Common Name | 4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl | ||
|---|---|---|---|---|
| CAS Number | 119586-44-6 | Molecular Weight | 748.994 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 896.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C56H48N2 | Melting Point | 232-234ºC | |
| MSDS | Chinese USA | Flash Point | 381.6±22.1 °C | |
| Name | 4,4'-Bis[4-(di-p-tolylamino)styryl]biphenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 896.1±65.0 °C at 760 mmHg |
| Melting Point | 232-234ºC |
| Molecular Formula | C56H48N2 |
| Molecular Weight | 748.994 |
| Flash Point | 381.6±22.1 °C |
| Exact Mass | 748.381775 |
| PSA | 6.48000 |
| LogP | 18.09 |
| Vapour Pressure | 0.0±0.3 mmHg at 25°C |
| Index of Refraction | 1.707 |
| InChIKey | OSQXTXTYKAEHQV-WXUKJITCSA-N |
| SMILES | Cc1ccc(N(c2ccc(C)cc2)c2ccc(C=Cc3ccc(-c4ccc(C=Cc5ccc(N(c6ccc(C)cc6)c6ccc(C)cc6)cc5)cc4)cc3)cc2)cc1 |
| RIDADR | NONH for all modes of transport |
|---|
|
A stable blue host material for organic light-emitting diodes. Kim MS, et al.
Appl. Phys. Lett.
|
|
|
High-efficiency stacked white organic light-emitting diodes." Applied Physics Letters Lee TW, et al.
Appl. Phys. Lett.
|
|
|
Silicon‐Cored Anthracene Derivatives as Host Materials for Highly Efficient Blue Organic Light‐Emitting Devices. Lyu Yi Y, et al.
Adv. Mater.
|
| 4,4'-[4,4'-Biphenyldiyldi(E)-2,1-ethenediyl]bis[N,N-bis(4-methylphenyl)aniline] |
| 4,4'-[Biphenyl-4,4'-diyldi(E)ethene-2,1-diyl]bis[N,N-bis(4-methylphenyl)aniline] |
| Benzenamine, 4,4'-[[1,1'-biphenyl]-4,4'-diyldi(E)-2,1-ethenediyl]bis[N,N-bis(4-methylphenyl)- |
| 4,4'-Bis[2-[4-[N,N-di(p-tolyl)amino]phenyl]vinyl]biphenyl |
| 4,4'-Bis[4-(di-p-tolylamino)styryl] biphenyl |