Oxacyclotetradecane Erythromycin Derivatives
Modify Date: 2025-08-27 20:09:39
Oxacyclotetradecane Erythromycin Derivatives structure
|
Common Name | Oxacyclotetradecane Erythromycin Derivatives | ||
|---|---|---|---|---|
| CAS Number | 119665-77-9 | Molecular Weight | 835.1 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C42H78N2O14 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Oxacyclotetradecane Erythromycin Derivatives |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C42H78N2O14 |
|---|---|
| Molecular Weight | 835.1 |
| InChIKey | BQIJMZDZVNPWGN-GKHWQSMJSA-N |
| SMILES | CCOC(C)(C)ON=C1C(C)CC(C)(O)C(OC2OC(C)CC(N(C)C)C2O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(=O)OC(CC)C(C)(O)C(O)C1C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 119665-77-9? |
| A: Chinese name of 119665-77-9 is 119665-77-9. |
| Q: What is the molecular weight of Oxacyclotetradecane Erythromycin Derivatives? |
| A: Molecular weight of Oxacyclotetradecane Erythromycin Derivatives is 835.1. |
| Q: What is the molecular formula of Oxacyclotetradecane Erythromycin Derivatives? |
| A: Molecular formula of Oxacyclotetradecane Erythromycin Derivatives is C42H78N2O14. |
| Q: What is the InChIKey of Oxacyclotetradecane Erythromycin Derivatives? |
| A: InChIKey of Oxacyclotetradecane Erythromycin Derivatives is BQIJMZDZVNPWGN-GKHWQSMJSA-N. |
| Q: What is the SMILES notation of Oxacyclotetradecane Erythromycin Derivatives? |
| A: SMILES notation of Oxacyclotetradecane Erythromycin Derivatives is CCOC(C)(C)ON=C1C(C)CC(C)(O)C(OC2OC(C)CC(N(C)C)C2O)C(C)C(OC2CC(C)(OC)C(O)C(C)O2)C(C)C(=O)OC(CC)C(C)(O)C(O)C1C. |
| Q: What is the English name of Oxacyclotetradecane Erythromycin Derivatives? |
| A: The English name of Oxacyclotetradecane Erythromycin Derivatives is Oxacyclotetradecane Erythromycin Derivatives. |
| Q: What is the CAS number of Oxacyclotetradecane Erythromycin Derivatives? |
| A: CAS number of Oxacyclotetradecane Erythromycin Derivatives is 119665-77-9. |