2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid
Modify Date: 2025-09-09 17:45:47
2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid structure
|
Common Name | 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1197372-69-2 | Molecular Weight | 234.21 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H10N2O4 |
|---|---|
| Molecular Weight | 234.21 |
| InChIKey | VBUSXAGDPKWPMM-UHFFFAOYSA-N |
| SMILES | COc1cc(-c2noc(C)n2)ccc1C(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid? |
| A: InChIKey of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is VBUSXAGDPKWPMM-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 1197372-69-2? |
| A: Chinese name of 1197372-69-2 is 1197372-69-2. |
| Q: What is the molecular weight of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid? |
| A: Molecular weight of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is 234.21. |
| Q: What is the CAS number of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid? |
| A: CAS number of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is 1197372-69-2. |
| Q: What is the English name of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid? |
| A: The English name of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid. |
| Q: What is the SMILES notation of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid? |
| A: SMILES notation of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is COc1cc(-c2noc(C)n2)ccc1C(=O)O. |
| Q: What is the molecular formula of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid? |
| A: Molecular formula of 2-Methoxy-4-(5-methyl-1,2,4-oxadiazol-3-yl)benzoic acid is C11H10N2O4. |