US9868729, Example 185
Modify Date: 2026-03-04 18:14:32
US9868729, Example 185 structure
|
Common Name | US9868729, Example 185 | ||
|---|---|---|---|---|
| CAS Number | 1198301-56-2 | Molecular Weight | 337.34 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H15N9O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | US9868729, Example 185 |
|---|
| Molecular Formula | C15H15N9O |
|---|---|
| Molecular Weight | 337.34 |
| InChIKey | RFJOCHLDMCMRML-UHFFFAOYSA-N |
| SMILES | C1CC1NC2=NC(=NC=C2C(=O)N)NC3=CC=C(C=C3)N4C=NN=N4 |
|
Name: Inhibition of Syk and JAK Kinases from US Patent US11414410: "Inhibitors of protein k...
Source: BindingDB
Target: N/A
External Id: BindingDB_10761_1
|
|
Name: Kinase Assay from US Patent US10533001: "Inhibitors of protein kinases"
Source: BindingDB
Target: N/A
External Id: BindingDB_8915_1
|
|
Name: In Vitro Assay from US Patent US9868729: "Inhibitors of protein kinases"
Source: BindingDB
Target: N/A
External Id: BindingDB_2438_1
|
Total 3, Current Page 1 of 1
1