3,5-Bis(tritylthio)benzoic acid
Modify Date: 2025-08-28 18:05:08
3,5-Bis(tritylthio)benzoic acid structure
|
Common Name | 3,5-Bis(tritylthio)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1198564-68-9 | Molecular Weight | 670.9 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C45H34O2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,5-Bis(tritylthio)benzoic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C45H34O2S2 |
|---|---|
| Molecular Weight | 670.9 |
| InChIKey | ANQRDAWNYSZAOP-UHFFFAOYSA-N |
| SMILES | O=C(O)c1cc(SC(c2ccccc2)(c2ccccc2)c2ccccc2)cc(SC(c2ccccc2)(c2ccccc2)c2ccccc2)c1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of 3,5-Bis(tritylthio)benzoic acid? |
| A: Molecular weight of 3,5-Bis(tritylthio)benzoic acid is 670.9. |
| Q: What is the CAS number of 3,5-Bis(tritylthio)benzoic acid? |
| A: CAS number of 3,5-Bis(tritylthio)benzoic acid is 1198564-68-9. |
| Q: What is the InChIKey of 3,5-Bis(tritylthio)benzoic acid? |
| A: InChIKey of 3,5-Bis(tritylthio)benzoic acid is ANQRDAWNYSZAOP-UHFFFAOYSA-N. |
| Q: What is the English name of 3,5-Bis(tritylthio)benzoic acid? |
| A: The English name of 3,5-Bis(tritylthio)benzoic acid is 3,5-Bis(tritylthio)benzoic acid. |
| Q: What is the molecular formula of 3,5-Bis(tritylthio)benzoic acid? |
| A: Molecular formula of 3,5-Bis(tritylthio)benzoic acid is C45H34O2S2. |
| Q: What is the SMILES notation of 3,5-Bis(tritylthio)benzoic acid? |
| A: SMILES notation of 3,5-Bis(tritylthio)benzoic acid is O=C(O)c1cc(SC(c2ccccc2)(c2ccccc2)c2ccccc2)cc(SC(c2ccccc2)(c2ccccc2)c2ccccc2)c1. |
| Q: What is the Chinese name of 1198564-68-9? |
| A: Chinese name of 1198564-68-9 is 1198564-68-9. |