3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime
Modify Date: 2026-07-15 20:20:03
3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime structure
|
Common Name | 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime | ||
|---|---|---|---|---|
| CAS Number | 1199253-23-0 | Molecular Weight | 221.64 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8ClN3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8ClN3O |
|---|---|
| Molecular Weight | 221.64 |
| InChIKey | YTQVKWAXAMQQNU-AWNIVKPZSA-N |
| SMILES | ON=Cc1cn[nH]c1-c1ccc(Cl)cc1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime? |
| A: The English name of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime is 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime. |
| Q: What is the molecular formula of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime? |
| A: Molecular formula of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime is C10H8ClN3O. |
| Q: What is the SMILES notation of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime? |
| A: SMILES notation of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime is ON=Cc1cn[nH]c1-c1ccc(Cl)cc1. |
| Q: What is the molecular weight of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime? |
| A: Molecular weight of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime is 221.64. |
| Q: What is the CAS number of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime? |
| A: CAS number of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime is 1199253-23-0. |
| Q: What is the Chinese name of 1199253-23-0? |
| A: Chinese name of 1199253-23-0 is 1199253-23-0. |
| Q: What is the InChIKey of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime? |
| A: InChIKey of 3-(4-chlorophenyl)-1H-pyrazole-4-carbaldehyde oxime is YTQVKWAXAMQQNU-AWNIVKPZSA-N. |