phenyl-[4-(trifluoromethyl)-1H-pyrrol-3-yl]methanone structure
|
Common Name | phenyl-[4-(trifluoromethyl)-1H-pyrrol-3-yl]methanone | ||
|---|---|---|---|---|
| CAS Number | 119982-27-3 | Molecular Weight | 239.19300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H8F3NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenyl-[4-(trifluoromethyl)-1H-pyrrol-3-yl]methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H8F3NO |
|---|---|
| Molecular Weight | 239.19300 |
| Exact Mass | 239.05600 |
| PSA | 32.86000 |
| LogP | 3.26450 |
| InChIKey | JGHGHHQQSMEQQB-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1c[nH]cc1C(F)(F)F |
|
~49%
phenyl-[4-(trif... CAS#:119982-27-3 |
| Literature: Aoyagi, Katsuhiro; Haga, Toshihiko; Toi, Hiroo; Aoyama, Yasuhiro; Mizutani, Tadashi; Ogoshi, Hisanobu Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 4 p. 937 - 943 |
|
~%
phenyl-[4-(trif... CAS#:119982-27-3 |
| Literature: Aoyagi, Katsuhiro; Haga, Toshihiko; Toi, Hiroo; Aoyama, Yasuhiro; Mizutani, Tadashi; Ogoshi, Hisanobu Bulletin of the Chemical Society of Japan, 1997 , vol. 70, # 4 p. 937 - 943 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3-benzoyl-4-trifluoromethylpyrrole |