isoeugenyl phenylacetate structure
|
Common Name | isoeugenyl phenylacetate | ||
|---|---|---|---|---|
| CAS Number | 120-24-1 | Molecular Weight | 282.33400 | |
| Density | 1.117g/cm3 | Boiling Point | 413.2ºC at 760mmHg | |
| Molecular Formula | C18H18O3 | Melting Point | N/A | |
| MSDS | USA | Flash Point | 175.4ºC | |
| Name | [2-methoxy-4-[(E)-prop-1-enyl]phenyl] 2-phenylacetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.117g/cm3 |
|---|---|
| Boiling Point | 413.2ºC at 760mmHg |
| Molecular Formula | C18H18O3 |
| Molecular Weight | 282.33400 |
| Flash Point | 175.4ºC |
| Exact Mass | 282.12600 |
| PSA | 35.53000 |
| LogP | 3.87640 |
| Vapour Pressure | 4.9E-07mmHg at 25°C |
| Index of Refraction | n20/D 1.577(lit.) |
| InChIKey | YYLCMLYMJHKLEJ-UHFFFAOYSA-N |
| SMILES | CC=Cc1ccc(OC(=O)Cc2ccccc2)c(OC)c1 |
| RIDADR | NONH for all modes of transport |
|---|---|
| WGK Germany | 3 |
| 4-Propenylguaiacyl phenylacetate |
| Isoeugenyl phenylacetate |
| 2-Methoxy-4-propenylphenyl phenylacetate |
| MFCD00048596 |
| FEMA No. 2477 |
| EINECS 204-381-6 |