3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one
Modify Date: 2025-09-10 06:33:20
![3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one Structure](https://www.chemsrc.com/extcaspic/449/120004-87-7.png)
3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one structure
|
Common Name | 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one | ||
|---|---|---|---|---|
| CAS Number | 120004-87-7 | Molecular Weight | 358.4 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H18N2O3 |
|---|---|
| Molecular Weight | 358.4 |
| InChIKey | CFXACCOGJNQFMK-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(cc1N)Oc1cc(N)c(C)cc1C21OC(=O)c2ccccc21 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 120004-87-7? |
| A: Chinese name of 120004-87-7 is 120004-87-7. |
| Q: What is the SMILES notation of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one? |
| A: SMILES notation of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one is Cc1cc2c(cc1N)Oc1cc(N)c(C)cc1C21OC(=O)c2ccccc21. |
| Q: What is the molecular weight of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one? |
| A: Molecular weight of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one is 358.4. |
| Q: What is the InChIKey of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one? |
| A: InChIKey of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one is CFXACCOGJNQFMK-UHFFFAOYSA-N. |
| Q: What is the English name of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one? |
| A: The English name of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one is 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one. |
| Q: What is the molecular formula of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one? |
| A: Molecular formula of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one is C22H18N2O3. |
| Q: What is the CAS number of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one? |
| A: CAS number of 3',6'-Diamino-2',7'-dimethyl-3H-spiro[isobenzofuran-1,9'-xanthen]-3-one is 120004-87-7. |