8-Methoxy-3-Methyl-1H-benzo[d]azepin-2(3H)-one structure
|
Common Name | 8-Methoxy-3-Methyl-1H-benzo[d]azepin-2(3H)-one | ||
|---|---|---|---|---|
| CAS Number | 120039-18-1 | Molecular Weight | 203.23700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H13NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-Methoxy-3-methyl-1,3-dihydro-2H-3-benzazepin-2-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H13NO2 |
|---|---|
| Molecular Weight | 203.23700 |
| Exact Mass | 203.09500 |
| PSA | 29.54000 |
| LogP | 1.61830 |
| InChIKey | BDKNXHUFOFANTF-UHFFFAOYSA-N |
| SMILES | COc1ccc2c(c1)CC(=O)N(C)C=C2 |
| HS Code | 2933990090 |
|---|
|
~86%
8-Methoxy-3-Met... CAS#:120039-18-1 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 17, # 24 p. 6841 - 6846 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 8-methoxy-3-methoxymethyl-2-methylphenanthrene-1,4-quinone |