4-methyl-3-(2,4,5-trimethoxy-3-methylphenylmethyl)-2,5-piperazinedione structure
|
Common Name | 4-methyl-3-(2,4,5-trimethoxy-3-methylphenylmethyl)-2,5-piperazinedione | ||
|---|---|---|---|---|
| CAS Number | 120040-29-1 | Molecular Weight | 322.35600 | |
| Density | 1.219g/cm3 | Boiling Point | 605ºC at 760 mmHg | |
| Molecular Formula | C16H22N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 319.7ºC | |
| Name | 1-methyl-6-[(2,4,5-trimethoxy-3-methylphenyl)methyl]piperazine-2,5-dione |
|---|
| Density | 1.219g/cm3 |
|---|---|
| Boiling Point | 605ºC at 760 mmHg |
| Molecular Formula | C16H22N2O5 |
| Molecular Weight | 322.35600 |
| Flash Point | 319.7ºC |
| Exact Mass | 322.15300 |
| PSA | 80.59000 |
| LogP | 0.73390 |
| Vapour Pressure | 1.38E-14mmHg at 25°C |
| Index of Refraction | 1.567 |
| InChIKey | IGYZMVXOHSZNIN-WDZFZDKYSA-N |
| SMILES | COc1cc(C=C2C(=O)NCC(=O)N2C)c(OC)c(C)c1OC |
|
~73%
4-methyl-3-(2,4... CAS#:120040-29-1 |
| Literature: Kubo; Saito; Yamato; Yamauchi; Hiruma; Inoue Chemical and Pharmaceutical Bulletin, 1988 , vol. 36, # 7 p. 2607 - 2614 |