5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine
![5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine Structure](https://image.chemsrc.com/caspic/005/120182-07-2.png)
5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine structure
|
Common Name | 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine | ||
|---|---|---|---|---|
| CAS Number | 120182-07-2 | Molecular Weight | 261.32300 | |
| Density | 1.37g/cm3 | Boiling Point | 438.4ºC at 760mmHg | |
| Molecular Formula | C13H19N5O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 218.9ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 438.4ºC at 760mmHg |
| Molecular Formula | C13H19N5O |
| Molecular Weight | 261.32300 |
| Flash Point | 218.9ºC |
| Exact Mass | 261.15900 |
| PSA | 64.48000 |
| LogP | 0.55820 |
| Vapour Pressure | 6.92E-08mmHg at 25°C |
| Index of Refraction | 1.68 |
| InChIKey | FDMZYWCLSJXOCU-UHFFFAOYSA-N |
| SMILES | NC1=NCC(CN2CCN(c3ccccn3)CC2)O1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
5-[(4-pyridin-2... CAS#:120182-07-2 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
|
~%
5-[(4-pyridin-2... CAS#:120182-07-2 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
|
~%
5-[(4-pyridin-2... CAS#:120182-07-2 |
| Literature: Bosc; Jarry; Carpy; Panconi; Descas European Journal of Medicinal Chemistry, 1992 , vol. 27, # 5 p. 437 - 442 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 3 | |
|---|---|
| DownStream 0 | |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: InChIKey of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is FDMZYWCLSJXOCU-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 120182-07-2? |
| A: Chinese name of 120182-07-2 is 120182-07-2. |
| Q: What is the boiling point of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: Boiling point of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is 438.4ºC at 760mmHg. |
| Q: What is the molecular formula of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: Molecular formula of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is C13H19N5O. |
| Q: What is the English name of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: The English name of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine. |
| Q: What is the CAS number of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: CAS number of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is 120182-07-2. |
| Q: What is the molecular weight of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: Molecular weight of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is 261.32300. |
| Q: What are the upstream materials of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: Related upstream materials(CAS) of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine: 34803-66-2;73076-41-2;19981-17-0. |
| Q: What is the polar surface area (PSA) of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: Polar surface area (PSA) of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is 64.48000. |
| Q: What is the LogP of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine? |
| A: LogP of 5-[(4-pyridin-2-ylpiperazin-1-yl)methyl]-4,5-dihydro-1,3-oxazol-2-amine is 0.55820. |