4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid
Modify Date: 2026-09-28 14:40:56
![4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid Structure](https://www.chemsrc.com/extcaspic/010/120237-60-7.png)
4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid structure
|
Common Name | 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid | ||
|---|---|---|---|---|
| CAS Number | 120237-60-7 | Molecular Weight | 242.25 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H10N2O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C9H10N2O4S |
|---|---|
| Molecular Weight | 242.25 |
| InChIKey | NRYUDFZIUVRYAF-UHFFFAOYSA-N |
| SMILES | C=CCOC(=O)Nc1nc(C)c(C(=O)O)s1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid? |
| A: Molecular formula of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid is C9H10N2O4S. |
| Q: What is the molecular weight of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid? |
| A: Molecular weight of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid is 242.25. |
| Q: What is the Chinese name of 120237-60-7? |
| A: Chinese name of 120237-60-7 is 120237-60-7. |
| Q: What is the CAS number of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid? |
| A: CAS number of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid is 120237-60-7. |
| Q: What is the English name of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid? |
| A: The English name of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid is 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid. |
| Q: What is the InChIKey of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid? |
| A: InChIKey of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid is NRYUDFZIUVRYAF-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid? |
| A: SMILES notation of 4-Methyl-2-{[(prop-2-en-1-yloxy)carbonyl]amino}-1,3-thiazole-5-carboxylic acid is C=CCOC(=O)Nc1nc(C)c(C(=O)O)s1. |