molybdenum silicide
Modify Date: 2026-07-04 11:36:07
molybdenum silicide structure
|
Common Name | molybdenum silicide | ||
|---|---|---|---|---|
| CAS Number | 12033-40-8 | Molecular Weight | 248.12700 | |
| Density | 8.2 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | MoO6Si2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dioxido(oxo)silane,molybdenum(4+) |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 8.2 g/cm3 |
|---|---|
| Molecular Formula | MoO6Si2 |
| Molecular Weight | 248.12700 |
| Exact Mass | 249.82900 |
| PSA | 126.38000 |
| InChIKey | JUYZUJLVHMHVIY-UHFFFAOYSA-N |
| SMILES | O=[Si]([O-])[O-].O=[Si]([O-])[O-].[Mo+4] |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Pentamolybdenum trisilicide |
| EINECS 234-786-3 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of dioxido(oxo)silane,molybdenum(4+)? |
| A: Molecular weight of dioxido(oxo)silane,molybdenum(4+) is 248.12700. |
| Q: What is the SMILES notation of dioxido(oxo)silane,molybdenum(4+)? |
| A: SMILES notation of dioxido(oxo)silane,molybdenum(4+) is O=[Si]([O-])[O-].O=[Si]([O-])[O-].[Mo+4]. |
| Q: What is the InChIKey of dioxido(oxo)silane,molybdenum(4+)? |
| A: InChIKey of dioxido(oxo)silane,molybdenum(4+) is JUYZUJLVHMHVIY-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of dioxido(oxo)silane,molybdenum(4+)? |
| A: Polar surface area (PSA) of dioxido(oxo)silane,molybdenum(4+) is 126.38000. |
| Q: What is the molecular formula of dioxido(oxo)silane,molybdenum(4+)? |
| A: Molecular formula of dioxido(oxo)silane,molybdenum(4+) is MoO6Si2. |
| Q: What English synonyms does dioxido(oxo)silane,molybdenum(4+) have? |
| A: English synonyms of dioxido(oxo)silane,molybdenum(4+): Pentamolybdenum trisilicide, EINECS 234-786-3. |
| Q: What is the CAS number of dioxido(oxo)silane,molybdenum(4+)? |
| A: CAS number of dioxido(oxo)silane,molybdenum(4+) is 12033-40-8. |
| Q: What is the English name of dioxido(oxo)silane,molybdenum(4+)? |
| A: The English name of dioxido(oxo)silane,molybdenum(4+) is dioxido(oxo)silane,molybdenum(4+). |