3-amino-2-benzyl-5-phenylthieno[2,3-d]pyrimidin-4-one
Modify Date: 2025-09-18 11:32:25
![3-amino-2-benzyl-5-phenylthieno[2,3-d]pyrimidin-4-one Structure](https://image.chemsrc.com/caspic/476/120354-28-1.png)
3-amino-2-benzyl-5-phenylthieno[2,3-d]pyrimidin-4-one structure
|
Common Name | 3-amino-2-benzyl-5-phenylthieno[2,3-d]pyrimidin-4-one | ||
|---|---|---|---|---|
| CAS Number | 120354-28-1 | Molecular Weight | 333.40700 | |
| Density | 1.34g/cm3 | Boiling Point | 548.6ºC at 760 mmHg | |
| Molecular Formula | C19H15N3OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 285.6ºC | |
| Name | 3-amino-2-benzyl-5-phenylthieno[2,3-d]pyrimidin-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.34g/cm3 |
|---|---|
| Boiling Point | 548.6ºC at 760 mmHg |
| Molecular Formula | C19H15N3OS |
| Molecular Weight | 333.40700 |
| Flash Point | 285.6ºC |
| Exact Mass | 333.09400 |
| PSA | 89.15000 |
| LogP | 4.01080 |
| Vapour Pressure | 4.34E-12mmHg at 25°C |
| Index of Refraction | 1.714 |
| InChIKey | LOZJWPIFPRGRAA-UHFFFAOYSA-N |
| SMILES | Nn1c(Cc2ccccc2)nc2scc(-c3ccccc3)c2c1=O |
|
~35%
3-amino-2-benzy... CAS#:120354-28-1 |
| Literature: Perrissin; Favre; Luu Duc; Huguet; Gaultier; Narcisse European Journal of Medicinal Chemistry, 1988 , vol. 23, # 5 p. 453 - 456 |
![ethyl 4-phenyl-2-[(2-phenylacetyl)amino]thiophene-3-carboxylate structure](https://image.chemsrc.com/caspic/378/77261-18-8.png)
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 3-Amino-5-phenyl-2-(phenylmethyl)thieno(2,3-d)pyrimidin-4(3H)-one |
| Thieno(2,3-d)pyrimidin-4(3H)-one,3-amino-5-phenyl-2-(phenylmethyl) |