2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride
Modify Date: 2026-08-09 02:56:13
2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride structure
|
Common Name | 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride | ||
|---|---|---|---|---|
| CAS Number | 1203686-72-9 | Molecular Weight | 243.73 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H18ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H18ClNO2 |
|---|---|
| Molecular Weight | 243.73 |
| InChIKey | ZRRAAFVIPBLDMA-UHFFFAOYSA-N |
| SMILES | COc1ccc(OC)c(C2CCCN2)c1.Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride? |
| A: InChIKey of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride is ZRRAAFVIPBLDMA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride? |
| A: Molecular weight of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride is 243.73. |
| Q: What is the SMILES notation of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride? |
| A: SMILES notation of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride is COc1ccc(OC)c(C2CCCN2)c1.Cl. |
| Q: What is the molecular formula of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride? |
| A: Molecular formula of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride is C12H18ClNO2. |
| Q: What is the CAS number of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride? |
| A: CAS number of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride is 1203686-72-9. |
| Q: What is the English name of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride? |
| A: The English name of 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride is 2-(2,5-Dimethoxyphenyl)pyrrolidine;hydrochloride. |
| Q: What is the Chinese name of 1203686-72-9? |
| A: Chinese name of 1203686-72-9 is 1203686-72-9. |