1-Methyl-3-octylimidazolium tricyanomethanide
Modify Date: 2026-07-03 13:21:10
1-Methyl-3-octylimidazolium tricyanomethanide structure
|
Common Name | 1-Methyl-3-octylimidazolium tricyanomethanide | ||
|---|---|---|---|---|
| CAS Number | 1203710-60-4 | Molecular Weight | 285.39 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 1-Methyl-3-octylimidazolium tricyanomethanide |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C16H23N5 |
|---|---|
| Molecular Weight | 285.39 |
| InChIKey | GANRCTJBAMDDJO-UHFFFAOYSA-N |
| SMILES | CCCCCCCCn1cc[n+](C)c1.N#CC(=C=[N-])C#N |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 1-Methyl-3-octylimidazolium tricyanomethanide? |
| A: The English name of 1-Methyl-3-octylimidazolium tricyanomethanide is 1-Methyl-3-octylimidazolium tricyanomethanide. |
| Q: What is the CAS number of 1-Methyl-3-octylimidazolium tricyanomethanide? |
| A: CAS number of 1-Methyl-3-octylimidazolium tricyanomethanide is 1203710-60-4. |
| Q: What is the SMILES notation of 1-Methyl-3-octylimidazolium tricyanomethanide? |
| A: SMILES notation of 1-Methyl-3-octylimidazolium tricyanomethanide is CCCCCCCCn1cc[n+](C)c1.N#CC(=C=[N-])C#N. |
| Q: What is the molecular formula of 1-Methyl-3-octylimidazolium tricyanomethanide? |
| A: Molecular formula of 1-Methyl-3-octylimidazolium tricyanomethanide is C16H23N5. |
| Q: What is the Chinese name of 1203710-60-4? |
| A: Chinese name of 1203710-60-4 is 1203710-60-4. |
| Q: What is the molecular weight of 1-Methyl-3-octylimidazolium tricyanomethanide? |
| A: Molecular weight of 1-Methyl-3-octylimidazolium tricyanomethanide is 285.39. |
| Q: What is the InChIKey of 1-Methyl-3-octylimidazolium tricyanomethanide? |
| A: InChIKey of 1-Methyl-3-octylimidazolium tricyanomethanide is GANRCTJBAMDDJO-UHFFFAOYSA-N. |