3-[(tert-Butoxycarbonyl)amino]-4-phenylbutanoic acid structure
|
Common Name | 3-[(tert-Butoxycarbonyl)amino]-4-phenylbutanoic acid | ||
|---|---|---|---|---|
| CAS Number | 120378-17-8 | Molecular Weight | 279.332 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 444.8±38.0 °C at 760 mmHg | |
| Molecular Formula | C15H21NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 222.8±26.8 °C | |
| Name | 3-[(2-methylpropan-2-yl)oxycarbonylamino]-4-phenylbutanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 444.8±38.0 °C at 760 mmHg |
| Molecular Formula | C15H21NO4 |
| Molecular Weight | 279.332 |
| Flash Point | 222.8±26.8 °C |
| Exact Mass | 279.147064 |
| PSA | 75.63000 |
| LogP | 3.18 |
| Vapour Pressure | 0.0±1.1 mmHg at 25°C |
| Index of Refraction | 1.525 |
| InChIKey | ACKWQHCPHJQANL-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)NC(CC(=O)O)Cc1ccccc1 |
| HS Code | 2924299090 |
|---|
|
~%
3-[(tert-Butoxy... CAS#:120378-17-8 |
| Literature: Pharmacia Italia S.p.A. Patent: US2007/142414 A1, 2007 ; Location in patent: Page/Page column 18 ; US 20070142414 A1 |
|
~%
3-[(tert-Butoxy... CAS#:120378-17-8 |
| Literature: PHARMACIA and ITALIA S.p.A. Patent: WO2005/14572 A1, 2005 ; Location in patent: Page/Page column 32 ; WO 2005/014572 A1 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-boc-amino-3-benzyl-propioinic acid |
| 3-[(tert-Butoxycarbonyl)amino]-4-phenylbutanoic acid |
| TMBA022 |
| 3-tert-butoxycarbonylamino-4-phenylbutyric acid |
| 3-({[(2-Methyl-2-propanyl)oxy]carbonyl}amino)-4-phenylbutanoic acid |
| Benzenebutanoic acid, β-[[(1,1-dimethylethoxy)carbonyl]amino]- |