3,3-dimethylbutyl (4-nitrophenyl) phosphate structure
|
Common Name | 3,3-dimethylbutyl (4-nitrophenyl) phosphate | ||
|---|---|---|---|---|
| CAS Number | 120448-50-2 | Molecular Weight | 302.24000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H17NO6P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3-dimethylbutyl (4-nitrophenyl) phosphate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H17NO6P |
|---|---|
| Molecular Weight | 302.24000 |
| Exact Mass | 302.07900 |
| PSA | 114.22000 |
| LogP | 4.48820 |
| InChIKey | QXPHTVBLNUPXBD-UHFFFAOYSA-M |
| SMILES | CC(C)(C)CCOP(=O)([O-])Oc1ccc([N+](=O)[O-])cc1 |
|
~%
3,3-dimethylbut... CAS#:120448-50-2 |
| Literature: Hengge, Alvan C.; Cleland Journal of the American Chemical Society, 1991 , vol. 113, # 15 p. 5835 - 5841 |
|
~%
3,3-dimethylbut... CAS#:120448-50-2 |
| Literature: Hengge, Alvan C.; Cleland Journal of the American Chemical Society, 1991 , vol. 113, # 15 p. 5835 - 5841 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 3,3-dimethylbutyl p-nitrophenyl phosphate |