2-Amino-4-(p-tolyl)-1H-pyrrole-3-carbonitrile structure
|
Common Name | 2-Amino-4-(p-tolyl)-1H-pyrrole-3-carbonitrile | ||
|---|---|---|---|---|
| CAS Number | 120450-05-7 | Molecular Weight | 197.236 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 488.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C12H11N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 249.4±28.7 °C | |
| Name | 2-Amino-4-(4-methylphenyl)-1H-pyrrole-3-carbonitrile |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 488.8±45.0 °C at 760 mmHg |
| Molecular Formula | C12H11N3 |
| Molecular Weight | 197.236 |
| Flash Point | 249.4±28.7 °C |
| Exact Mass | 197.095291 |
| PSA | 65.60000 |
| LogP | 3.56 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | HWOHHBHQMXCJJK-UHFFFAOYSA-N |
| SMILES | Cc1ccc(-c2c[nH]c(N)c2C#N)cc1 |
| HS Code | 2933990090 |
|---|
|
~%
2-Amino-4-(p-to... CAS#:120450-05-7 |
| Literature: THE REGENTS OF THE UNIVERSITY OF CALIFORNIA; Taunton, JR., John William; Maglathlin, Rebecca; Serafimova, Iana; Cohen, Michael S.; Miller, Rand; Paavilainen, Ville; McFarland, Jesse; Krishnan, Shyam Patent: US2013/35325 A1, 2013 ; |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 2-amino-4-p-tolyl-1H-pyrrole-3-carbonitrile |
| 2-Amino-4-(4-methylphenyl)-1H-pyrrole-3-carbonitrile |
| 1H-Pyrrole-3-carbonitrile, 2-amino-4-(4-methylphenyl)- |