dimethyl 7-methyl-1-benzothiophene-5,6-dicarboxylate structure
|
Common Name | dimethyl 7-methyl-1-benzothiophene-5,6-dicarboxylate | ||
|---|---|---|---|---|
| CAS Number | 120571-69-9 | Molecular Weight | 264.29700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H12O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | dimethyl 7-methyl-1-benzothiophene-5,6-dicarboxylate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H12O4S |
|---|---|
| Molecular Weight | 264.29700 |
| Exact Mass | 264.04600 |
| PSA | 80.84000 |
| LogP | 2.78290 |
| InChIKey | RWLXSLWBTVJGKA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc2ccsc2c(C)c1C(=O)OC |
|
~%
dimethyl 7-meth... CAS#:120571-69-9 |
| Literature: Jackson, P. Mark; Moody, Christopher J.; Shah, Pritom Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1990 , # 11 p. 2909 - 2918 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| dimethyl 7-methylbenzothiophene-5,6-dicarboxylate |