[(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine
Modify Date: 2025-08-25 18:55:56
amine Structure](https://www.chemsrc.com/extcaspic/138/1206115-57-2.png)
[(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine structure
|
Common Name | [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine | ||
|---|---|---|---|---|
| CAS Number | 1206115-57-2 | Molecular Weight | 298.19 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H13Cl2NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H13Cl2NO3S |
|---|---|
| Molecular Weight | 298.19 |
| InChIKey | FKVUERAJXIKVDE-UHFFFAOYSA-N |
| SMILES | Cc1c(Cl)ccc(S(=O)(=O)NCCCO)c1Cl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1206115-57-2? |
| A: Chinese name of 1206115-57-2 is 1206115-57-2. |
| Q: What is the SMILES notation of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine? |
| A: SMILES notation of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine is Cc1c(Cl)ccc(S(=O)(=O)NCCCO)c1Cl. |
| Q: What is the English name of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine? |
| A: The English name of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine is [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine. |
| Q: What is the CAS number of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine? |
| A: CAS number of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine is 1206115-57-2. |
| Q: What is the InChIKey of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine? |
| A: InChIKey of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine is FKVUERAJXIKVDE-UHFFFAOYSA-N. |
| Q: What is the molecular formula of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine? |
| A: Molecular formula of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine is C10H13Cl2NO3S. |
| Q: What is the molecular weight of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine? |
| A: Molecular weight of [(2,4-Dichloro-3-methylphenyl)sulfonyl](3-hydroxypropyl)amine is 298.19. |