6-(4-formyl-N-methylanilino)hexyl acetate structure
|
Common Name | 6-(4-formyl-N-methylanilino)hexyl acetate | ||
|---|---|---|---|---|
| CAS Number | 120654-22-0 | Molecular Weight | 277.35900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H23NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-(4-formyl-N-methylanilino)hexyl acetate |
|---|
| Molecular Formula | C16H23NO3 |
|---|---|
| Molecular Weight | 277.35900 |
| Exact Mass | 277.16800 |
| PSA | 46.61000 |
| LogP | 3.05880 |
| InChIKey | GDOADJDESNBAHV-UHFFFAOYSA-N |
| SMILES | CC(=O)OCCCCCCN(C)c1ccc(C=O)cc1 |
|
~85%
6-(4-formyl-N-m... CAS#:120654-22-0 |
| Literature: Maertens, Christophe; Zhang, Jian-Xin; Dubois, Philippe; Jerome, Robert Journal of the Chemical Society. Perkin Transactions 2, 1996 , vol. 4, p. 713 - 718 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |