tert-butyl 2-benzyl-2,7-diazaspiro[3.5]nonane-7-carboxylate structure
|
Common Name | tert-butyl 2-benzyl-2,7-diazaspiro[3.5]nonane-7-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 1206969-92-7 | Molecular Weight | 260.332 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 406.0±45.0 °C at 760 mmHg | |
| Molecular Formula | C15H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 199.3±28.7 °C | |
| Name | 2-Benzyl-2,7-diaza-spiro[3.5]nonane -7-carboxylic acid tert-butyl ester |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 406.0±45.0 °C at 760 mmHg |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.332 |
| Flash Point | 199.3±28.7 °C |
| Exact Mass | 260.152466 |
| PSA | 32.78000 |
| LogP | 1.85 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.591 |
| InChIKey | YTGCOTYSXLIHNV-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCC2(CC1)CN(Cc1ccccc1)C2 |
| HS Code | 2933990090 |
|---|
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Benzyl 2,7-diazaspiro[3.5]nonane-7-carboxylate |
| 2,7-Diazaspiro[3.5]nonane-7-carboxylic acid, phenylmethyl ester |
| tert-butyl 2-benzyl-2,7-diazaspiro[3.5]nonane-7-carboxylate |