2-(2,6-Dichlorophenyl)-5-oxazolemethanamine
Modify Date: 2025-09-15 18:35:23
2-(2,6-Dichlorophenyl)-5-oxazolemethanamine structure
|
Common Name | 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine | ||
|---|---|---|---|---|
| CAS Number | 1206979-35-2 | Molecular Weight | 243.09 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H8Cl2N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H8Cl2N2O |
|---|---|
| Molecular Weight | 243.09 |
| InChIKey | UZKIIDYVDMTMDE-UHFFFAOYSA-N |
| SMILES | NCc1cnc(-c2c(Cl)cccc2Cl)o1 |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 1206979-35-2? |
| A: Chinese name of 1206979-35-2 is 1206979-35-2. |
| Q: What is the SMILES notation of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine? |
| A: SMILES notation of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine is NCc1cnc(-c2c(Cl)cccc2Cl)o1. |
| Q: What is the English name of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine? |
| A: The English name of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine is 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine. |
| Q: What is the molecular weight of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine? |
| A: Molecular weight of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine is 243.09. |
| Q: What is the InChIKey of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine? |
| A: InChIKey of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine is UZKIIDYVDMTMDE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine? |
| A: CAS number of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine is 1206979-35-2. |
| Q: What is the molecular formula of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine? |
| A: Molecular formula of 2-(2,6-Dichlorophenyl)-5-oxazolemethanamine is C10H8Cl2N2O. |