5-chloro-2-(3,5-dimethoxyphenyl)-1,3-thiazole structure
|
Common Name | 5-chloro-2-(3,5-dimethoxyphenyl)-1,3-thiazole | ||
|---|---|---|---|---|
| CAS Number | 1207426-83-2 | Molecular Weight | 255.72100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H10ClNO2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-chloro-2-(3,5-dimethoxyphenyl)-1,3-thiazole |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H10ClNO2S |
|---|---|
| Molecular Weight | 255.72100 |
| Exact Mass | 255.01200 |
| PSA | 59.59000 |
| LogP | 3.48070 |
| InChIKey | FCPXHKWSVSJFBG-UHFFFAOYSA-N |
| SMILES | COc1cc(OC)cc(-c2ncc(Cl)s2)c1 |
| HS Code | 2934100090 |
|---|
|
~87%
5-chloro-2-(3,5... CAS#:1207426-83-2 |
| Literature: Liegault, Benoit; Petrov, Ivan; Gorelsky, Serge I.; Fagnou, Keith Journal of Organic Chemistry, 2010 , vol. 75, # 4 p. 1047 - 1060 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2934100090 |
|---|---|
| Summary | 2934100090 other compounds containing an unfused thiazole ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 5-chloro-2-(3,5-dimethoxyphenyl)thiazole |