Ampicillin EP Impurity E structure
|
Common Name | Ampicillin EP Impurity E | ||
|---|---|---|---|---|
| CAS Number | 1207726-28-0 | Molecular Weight | 482.55200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C24H26N4O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Ampicillin EP Impurity EAmpicillin EP Impurity E is an impurity of Ampicillin --- an antibiotic used to prevent and treat a number of bacterial infections such as respiratory tract infections, urinary tract infections, meningitis, salmonella infections, and endocarditis. Ampicillin EP Impurity E can be used to detect compounds or impurities related to ampicillin in bulk drug. |
| Name | (2R)-2-[[(2S,5R,6R)-6-[[(2R)-2-amino-2-phenylacetyl]amino]-3,3-dimethyl-7-oxo-4-thia-1-azabicyclo[3.2.0]heptane-2-carbonyl]amino]-2-phenylacetic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C24H26N4O5S |
|---|---|
| Molecular Weight | 482.55200 |
| Exact Mass | 482.16200 |
| PSA | 174.11000 |
| LogP | 3.49440 |
| InChIKey | VSAAMYOCWYQYDF-OSAVLUCMSA-N |
| SMILES | CC1(C)SC2C(NC(=O)C(N)c3ccccc3)C(=O)N2C1C(=O)NC(C(=O)O)c1ccccc1 |
| Ampicillinyl-D-phenylglycine |
| UNII-7811RA358Y |
| Ampicillin Impurity 5 |