Bozepinib structure
|
Common Name | Bozepinib | ||
|---|---|---|---|---|
| CAS Number | 1207993-83-6 | Molecular Weight | 521.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H14Cl2N6O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BozepinibNovel antitumor agent, inducing PKR-mediated apoptosis and synergizing with IFN |
| Name | Bozepinib |
|---|
| Description | Novel antitumor agent, inducing PKR-mediated apoptosis and synergizing with IFN |
|---|
| Molecular Formula | C20H14Cl2N6O5S |
|---|---|
| Molecular Weight | 521.33 |
| InChIKey | ADWZQHLAYGEBHB-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1ccc(S(=O)(=O)N2CC(n3cnc4c(Cl)nc(Cl)nc43)OCc3ccccc32)cc1 |