2,7-dimethoxyacridin-9(10H)one
2,7-dimethoxyacridin-9(10H)one structure
|
Common Name | 2,7-dimethoxyacridin-9(10H)one | ||
|---|---|---|---|---|
| CAS Number | 120809-05-4 | Molecular Weight | 255.26900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2,7-dimethoxyacridin-9(10H)one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13NO3 |
|---|---|
| Molecular Weight | 255.26900 |
| Exact Mass | 255.09000 |
| PSA | 51.32000 |
| LogP | 2.69850 |
| InChIKey | LRCYXJSQZFOQKS-UHFFFAOYSA-N |
| SMILES | COc1ccc2[nH]c3ccc(OC)cc3c(=O)c2c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:6526-92-7This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| .2,7-dimethoxyacridone |
| .2,7-Dimethoxy-10H-acridin-9-on |
| 2,7-Dimethoxyacridan-9-one |
| .2,7-dimethoxy-10H-acridin-9-one |
| 2,7-Dimethoxy-9-acridinone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2,7-dimethoxyacridin-9(10H)one? |
| A: Polar surface area (PSA) of 2,7-dimethoxyacridin-9(10H)one is 51.32000. |
| Q: What English synonyms does 2,7-dimethoxyacridin-9(10H)one have? |
| A: English synonyms of 2,7-dimethoxyacridin-9(10H)one: .2,7-dimethoxyacridone, .2,7-Dimethoxy-10H-acridin-9-on, 2,7-Dimethoxyacridan-9-one, .2,7-dimethoxy-10H-acridin-9-one, 2,7-Dimethoxy-9-acridinone. |
| Q: What is the InChIKey of 2,7-dimethoxyacridin-9(10H)one? |
| A: InChIKey of 2,7-dimethoxyacridin-9(10H)one is LRCYXJSQZFOQKS-UHFFFAOYSA-N. |
| Q: What are the downstream products of 2,7-dimethoxyacridin-9(10H)one? |
| A: Related downstream products(CAS) of 2,7-dimethoxyacridin-9(10H)one: 6526-92-7. |
| Q: What is the molecular weight of 2,7-dimethoxyacridin-9(10H)one? |
| A: Molecular weight of 2,7-dimethoxyacridin-9(10H)one is 255.26900. |
| Q: What is the Chinese name of 120809-05-4? |
| A: Chinese name of 120809-05-4 is 120809-05-4. |
| Q: What is the molecular formula of 2,7-dimethoxyacridin-9(10H)one? |
| A: Molecular formula of 2,7-dimethoxyacridin-9(10H)one is C15H13NO3. |
| Q: What is the English name of 2,7-dimethoxyacridin-9(10H)one? |
| A: The English name of 2,7-dimethoxyacridin-9(10H)one is 2,7-dimethoxyacridin-9(10H)one. |
| Q: What is the SMILES notation of 2,7-dimethoxyacridin-9(10H)one? |
| A: SMILES notation of 2,7-dimethoxyacridin-9(10H)one is COc1ccc2[nH]c3ccc(OC)cc3c(=O)c2c1. |
| Q: What is the CAS number of 2,7-dimethoxyacridin-9(10H)one? |
| A: CAS number of 2,7-dimethoxyacridin-9(10H)one is 120809-05-4. |