dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate
Modify Date: 2026-07-18 06:23:55
dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate structure
|
Common Name | dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate | ||
|---|---|---|---|---|
| CAS Number | 120849-44-7 | Molecular Weight | 262.30 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H22O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H22O6 |
|---|---|
| Molecular Weight | 262.30 |
| InChIKey | WPUGGBMWCULBMS-NXEZZACHSA-N |
| SMILES | CC(C)OC(=O)CC(O)C(O)CC(=O)OC(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate? |
| A: Molecular formula of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate is C12H22O6. |
| Q: What is the SMILES notation of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate? |
| A: SMILES notation of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate is CC(C)OC(=O)CC(O)C(O)CC(=O)OC(C)C. |
| Q: What is the English name of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate? |
| A: The English name of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate is dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate. |
| Q: What is the molecular weight of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate? |
| A: Molecular weight of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate is 262.30. |
| Q: What is the InChIKey of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate? |
| A: InChIKey of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate is WPUGGBMWCULBMS-NXEZZACHSA-N. |
| Q: What is the Chinese name of 120849-44-7? |
| A: Chinese name of 120849-44-7 is 120849-44-7. |
| Q: What is the CAS number of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate? |
| A: CAS number of dipropan-2-yl (3R,4R)-3,4-dihydroxyhexanedioate is 120849-44-7. |