Ethyl 4-fluoro-2-nitrophenylacetate structure
|
Common Name | Ethyl 4-fluoro-2-nitrophenylacetate | ||
|---|---|---|---|---|
| CAS Number | 1209007-72-6 | Molecular Weight | 227.18900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H10FNO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | Ethyl (4-fluoro-2-nitrophenyl)acetate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C10H10FNO4 |
|---|---|
| Molecular Weight | 227.18900 |
| Exact Mass | 227.05900 |
| PSA | 72.12000 |
| LogP | 2.36270 |
| InChIKey | WZJVOVVGHUMGBD-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Cc1ccc(F)cc1[N+](=O)[O-] |
|
~74%
Ethyl 4-fluoro-... CAS#:1209007-72-6 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 5 p. 1580 - 1593 |
|
~%
Ethyl 4-fluoro-... CAS#:1209007-72-6 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 19, # 5 p. 1580 - 1593 |
| 4,7-Octadienoic acid,3,3-dimethyl-,ethyl ester |
| ethyl (4E)-3,3-dimethylocta-4,7-dienoate |