5-Methyl-2-(trifluoromethyl)benzoic acid structure
|
Common Name | 5-Methyl-2-(trifluoromethyl)benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 120985-68-4 | Molecular Weight | 204.14600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C9H7F3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-Methyl-2-(trifluoromethyl)benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C9H7F3O2 |
|---|---|
| Molecular Weight | 204.14600 |
| Exact Mass | 204.04000 |
| PSA | 37.30000 |
| LogP | 2.71200 |
| InChIKey | YYEMDMKMHBXYPV-UHFFFAOYSA-N |
| SMILES | Cc1ccc(C(F)(F)F)c(C(=O)O)c1 |
| HS Code | 2916399090 |
|---|
|
~%
5-Methyl-2-(tri... CAS#:120985-68-4 |
| Literature: Kuwabara, Masaki; Murakami, Akira; Fukunishi, Koushi; Nomura, Mototeru; Yamanaka, Hiroki Journal of Fluorine Chemistry, 1989 , vol. 42, p. 105 - 118 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| JRD-1905 |
| 5-Methyl-2-trifluoromethyl-benzoic acid |
| 2-trifluoromethyl-5-methylbenzoic acid |