2,5-Cyclohexadien-1-one,4-[(2,4-diamino-5-methylphenyl)imino]- structure
|
Common Name | 2,5-Cyclohexadien-1-one,4-[(2,4-diamino-5-methylphenyl)imino]- | ||
|---|---|---|---|---|
| CAS Number | 121-23-3 | Molecular Weight | 227.26200 | |
| Density | 1.26g/cm3 | Boiling Point | 454.4ºC at 760mmHg | |
| Molecular Formula | C13H13N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 228.6ºC | |
| Name | 4-(2,4-diamino-5-methylphenyl)iminocyclohexa-2,5-dien-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.26g/cm3 |
|---|---|
| Boiling Point | 454.4ºC at 760mmHg |
| Molecular Formula | C13H13N3O |
| Molecular Weight | 227.26200 |
| Flash Point | 228.6ºC |
| Exact Mass | 227.10600 |
| PSA | 81.47000 |
| LogP | 3.08940 |
| Vapour Pressure | 1.9E-08mmHg at 25°C |
| Index of Refraction | 1.642 |
| InChIKey | HAXAVAPYQCRUSA-UHFFFAOYSA-N |
| SMILES | Cc1cc(N=C2C=CC(=O)C=C2)c(N)cc1N |
| HS Code | 2925290090 |
|---|
| HS Code | 2925290090 |
|---|---|
| Summary | 2925290090 other imines and their derivatives; salts thereof。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 5-Amino-2-methyl-benzochinon-(1.4)-imid-(1)-(4-oxy-anil)-(4) |
| 4-[(2,4-diamino-5-methylphenyl)imino]cyclohexa-2,5-dien-1-one |
| [1,4]Benzochinon-mono-(2,4-diamino-5-methyl-phenylimin) |
| EINECS 204-457-9 |
| [1,4]benzoquinone-mono-(2,4-diamino-5-methyl-phenylimine) |
| 2'-Amino-5'-methylindoaniline |
| 2,5-Cyclohexadien-1-one,4-[(4,6-diamino-m-tolyl)imino] |