4-Acetoxy-3-nitrobenzoic acid structure
|
Common Name | 4-Acetoxy-3-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 1210-97-5 | Molecular Weight | 225.15500 | |
| Density | 1.486±0.06 g/cm3 | Boiling Point | 403.0±40.0 °C | |
| Molecular Formula | C9H7NO6 | Melting Point | 156-158 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-acetyloxy-3-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.486±0.06 g/cm3 |
|---|---|
| Boiling Point | 403.0±40.0 °C |
| Melting Point | 156-158 °C |
| Molecular Formula | C9H7NO6 |
| Molecular Weight | 225.15500 |
| Exact Mass | 225.02700 |
| PSA | 109.42000 |
| LogP | 1.74150 |
| InChIKey | DLWDJCOJYCKWHN-UHFFFAOYSA-N |
| SMILES | CC(=O)Oc1ccc(C(=O)O)cc1[N+](=O)[O-] |
| HS Code | 2918990090 |
|---|
|
~69%
4-Acetoxy-3-nit... CAS#:1210-97-5 |
| Literature: Ikeda, Tomiki; Tazuke, Shigeo; Bamford, Clement H. Journal of Chemical Research, Miniprint, 1985 , # 6 p. 2030 - 2060 |
|
~%
4-Acetoxy-3-nit... CAS#:1210-97-5 |
| Literature: Baroni; Kleinau Monatshefte fuer Chemie, 1936 , vol. 68, p. 251,258 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 4-Acetoxy-3-nitro-benzoesaeure |
| 4-acetoxy-3-nitro-benzoic acid |
| Benzoic acid,4-(acetyloxy)-3-nitro |
| 4-(Acetyloxy)-3-nitrobenzoic acid |