16alpha-Acetoxycalotropin
Modify Date: 2026-06-27 11:34:06
16alpha-Acetoxycalotropin structure
|
Common Name | 16alpha-Acetoxycalotropin | ||
|---|---|---|---|---|
| CAS Number | 121007-11-2 | Molecular Weight | 590.7 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C31H42O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 16alpha-Acetoxycalotropin |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C31H42O11 |
|---|---|
| Molecular Weight | 590.7 |
| InChIKey | BMPDNBQADRWROC-MVELXVHSSA-N |
| SMILES | C[C@@H]1C[C@@H]([C@]2([C@@H](O1)O[C@@H]3C[C@@H]4CC[C@@H]5[C@@H]([C@]4(C[C@H]3O2)C=O)CC[C@]6([C@@]5(C[C@H]([C@@H]6C7=CC(=O)OC7)OC(=O)C)O)C)O)O |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Cytotoxicity against human HepG2 cells by MTT assay
Source: ChEMBL
Target: HepG2
External Id: CHEMBL954317
|
|
Name: Cytotoxicity against human HepG2 cells after 3 days by MTT assay
Source: ChEMBL
Target: HepG2
External Id: CHEMBL998264
|
|
Name: Cytotoxicity against human MDA-MB-231 cells after 3 days by MTT assay
Source: ChEMBL
Target: MDA-MB-231
External Id: CHEMBL998262
|
|
Name: Cytotoxicity against human MCF7 cells after 3 days by MTT assay
Source: ChEMBL
Target: MCF7
External Id: CHEMBL998263
|
|
Name: Cytotoxicity against human A549 cells after 3 days by MTT assay
Source: ChEMBL
Target: A549
External Id: CHEMBL998261
|
|
Name: Cytotoxicity against human Raji cells by MTT assay
Source: ChEMBL
Target: Raji
External Id: CHEMBL954318
|
Total 6, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the Chinese name of 121007-11-2? |
| A: Chinese name of 121007-11-2 is 121007-11-2. |
| Q: What is the molecular formula of 16alpha-Acetoxycalotropin? |
| A: Molecular formula of 16alpha-Acetoxycalotropin is C31H42O11. |
| Q: What is the CAS number of 16alpha-Acetoxycalotropin? |
| A: CAS number of 16alpha-Acetoxycalotropin is 121007-11-2. |
| Q: What is the InChIKey of 16alpha-Acetoxycalotropin? |
| A: InChIKey of 16alpha-Acetoxycalotropin is BMPDNBQADRWROC-MVELXVHSSA-N. |
| Q: What is the molecular weight of 16alpha-Acetoxycalotropin? |
| A: Molecular weight of 16alpha-Acetoxycalotropin is 590.7. |
| Q: What is the SMILES notation of 16alpha-Acetoxycalotropin? |
| A: SMILES notation of 16alpha-Acetoxycalotropin is C[C@@H]1C[C@@H]([C@]2([C@@H](O1)O[C@@H]3C[C@@H]4CC[C@@H]5[C@@H]([C@]4(C[C@H]3O2)C=O)CC[C@]6([C@@]5(C[C@H]([C@@H]6C7=CC(=O)OC7)OC(=O)C)O)C)O)O. |
| Q: What is the English name of 16alpha-Acetoxycalotropin? |
| A: The English name of 16alpha-Acetoxycalotropin is 16alpha-Acetoxycalotropin. |