(R)-5-tert-Butyl 1-methyl 2-aminopentanedioate
Modify Date: 2026-09-20 11:14:39
(R)-5-tert-Butyl 1-methyl 2-aminopentanedioate structure
|
Common Name | (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate | ||
|---|---|---|---|---|
| CAS Number | 121069-22-5 | Molecular Weight | 217.26 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C10H19NO4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C10H19NO4 |
|---|---|
| Molecular Weight | 217.26 |
| InChIKey | JKIPBZRGKFRHKQ-SSDOTTSWSA-N |
| SMILES | COC(=O)C(N)CCC(=O)OC(C)(C)C |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate? |
| A: CAS number of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate is 121069-22-5. |
| Q: What is the InChIKey of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate? |
| A: InChIKey of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate is JKIPBZRGKFRHKQ-SSDOTTSWSA-N. |
| Q: What is the Chinese name of 121069-22-5? |
| A: Chinese name of 121069-22-5 is 121069-22-5. |
| Q: What is the English name of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate? |
| A: The English name of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate is (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate. |
| Q: What is the molecular weight of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate? |
| A: Molecular weight of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate is 217.26. |
| Q: What is the SMILES notation of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate? |
| A: SMILES notation of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate is COC(=O)C(N)CCC(=O)OC(C)(C)C. |
| Q: What is the molecular formula of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate? |
| A: Molecular formula of (R)-5-tert-Butyl 1-methyl 2-aminopentanedioate is C10H19NO4. |